CAS 189811-57-2 appears in our catalog under these names: 1,2-Dihydro Acenaphthylene-13C6, 1,2-Dihydroacenaphthylene-13C6. Offered by: TRC, MedChemExpress. Available pack sizes: 25mg, Get quote.
1,2-dihydroacenaphthylene (CAS 189811-57-2) is a chemical compound with the molecular formula C12H10 and a molecular weight of 160.16 g/mol. IUPAC name: 1,2-dihydroacenaphthylene. InChIKey: CWRYPZZKDGJXCA-INDGIYAYSA-N.
| Molecular formula | C12H10 |
|---|---|
| Molecular weight | 160.16 g/mol |
| IUPAC name | 1,2-dihydroacenaphthylene |
| InChIKey | CWRYPZZKDGJXCA-INDGIYAYSA-N |
| SMILES | C1C[13C]2=[13CH][13CH]=[13CH][13C]3=[13C]2C1=CC=C3 |
Computed by PubChem (NCBI)