CAS 2663618-52-6 is the registry number for Rel-(1R,1aR,6aR)-1-ethynyl-1,1a,6,6a-tetrahydrocyclopropa[a]indene, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(1R,1aR,6aR)-1-ethynyl-1,1a,6,6a-tetrahydrocyclopropa[a]indene (CAS 2663618-52-6) is a chemical compound with the molecular formula C12H10 and a molecular weight of 154.21 g/mol. IUPAC name: (1R,1aR,6aR)-1-ethynyl-1,1a,6,6a-tetrahydrocyclopropa[a]indene. InChIKey: WDKANYKNRFDRAI-YUSALJHKSA-N.
| Molecular formula | C12H10 |
|---|---|
| Molecular weight | 154.21 g/mol |
| IUPAC name | (1R,1aR,6aR)-1-ethynyl-1,1a,6,6a-tetrahydrocyclopropa[a]indene |
| InChIKey | WDKANYKNRFDRAI-YUSALJHKSA-N |
| SMILES | C#C[C@@H]1[C@@H]2[C@H]1C3=CC=CC=C3C2 |
Computed by PubChem (NCBI)