Products 1041421-94-6
CAS 1041421-94-6 is the registry number for 5-Formyl-N,N-dimethylpyrazole-1-sulfonamide, 98%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
5-formyl-N,N-dimethylpyrazole-1-sulfonamide (CAS 1041421-94-6) is a chemical compound with the molecular formula C6H9N3O3S and a molecular weight of 203.22 g/mol. IUPAC name: 5-formyl-N,N-dimethylpyrazole-1-sulfonamide. InChIKey: ROCRDNKCRMQSQI-UHFFFAOYSA-N.
| Molecular formula | C6H9N3O3S |
|---|---|
| Molecular weight | 203.22 g/mol |
| IUPAC name | 5-formyl-N,N-dimethylpyrazole-1-sulfonamide |
| InChIKey | ROCRDNKCRMQSQI-UHFFFAOYSA-N |
| SMILES | CN(C)S(=O)(=O)N1C(=CC=N1)C=O |
Computed by PubChem (NCBI)