CAS 2908-73-8 is the registry number for 4-Amino-2-methyl-5-pyrimidinemethanesulfonic acid, >95% (HPLC). Offered by: TRC. Available pack sizes: 100mg, 250mg, 25mg.
(4-amino-2-methylpyrimidin-5-yl)methanesulfonic acid (CAS 2908-73-8) is a chemical compound with the molecular formula C6H9N3O3S and a molecular weight of 203.22 g/mol. IUPAC name: (4-amino-2-methylpyrimidin-5-yl)methanesulfonic acid. InChIKey: BONBSNIMLNTEIY-UHFFFAOYSA-N.
| Molecular formula | C6H9N3O3S |
|---|---|
| Molecular weight | 203.22 g/mol |
| IUPAC name | (4-amino-2-methylpyrimidin-5-yl)methanesulfonic acid |
| InChIKey | BONBSNIMLNTEIY-UHFFFAOYSA-N |
| SMILES | CC1=NC=C(C(=N1)N)CS(=O)(=O)O |
Computed by PubChem (NCBI)