Products 1603237-46-2
CAS 1603237-46-2 is the registry number for (5-Cyclopropyl-1,2,4-oxadiazol-3-yl)methanesulfonamide. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
(5-cyclopropyl-1,2,4-oxadiazol-3-yl)methanesulfonamide (CAS 1603237-46-2) is a chemical compound with the molecular formula C6H9N3O3S and a molecular weight of 203.22 g/mol. IUPAC name: (5-cyclopropyl-1,2,4-oxadiazol-3-yl)methanesulfonamide. InChIKey: SGCYRPRCIMFBFV-UHFFFAOYSA-N.
| Molecular formula | C6H9N3O3S |
|---|---|
| Molecular weight | 203.22 g/mol |
| IUPAC name | (5-cyclopropyl-1,2,4-oxadiazol-3-yl)methanesulfonamide |
| InChIKey | SGCYRPRCIMFBFV-UHFFFAOYSA-N |
| SMILES | C1CC1C2=NC(=NO2)CS(=O)(=O)N |
Computed by PubChem (NCBI)