CAS 1041437-98-2 is the registry number for ((2-fluorophenyl)sulfonyl)leucine, 95%. Offered by: AmBeed. Available pack sizes: 5g, 10g.
2-[(2-fluorophenyl)sulfonylamino]-4-methylpentanoic acid (CAS 1041437-98-2) is a chemical compound with the molecular formula C12H16FNO4S and a molecular weight of 289.33 g/mol. IUPAC name: 2-[(2-fluorophenyl)sulfonylamino]-4-methylpentanoic acid. InChIKey: DNXZNZQLHQZNLP-UHFFFAOYSA-N.
| Molecular formula | C12H16FNO4S |
|---|---|
| Molecular weight | 289.33 g/mol |
| IUPAC name | 2-[(2-fluorophenyl)sulfonylamino]-4-methylpentanoic acid |
| InChIKey | DNXZNZQLHQZNLP-UHFFFAOYSA-N |
| SMILES | CC(C)CC(C(=O)O)NS(=O)(=O)C1=CC=CC=C1F |
Computed by PubChem (NCBI)