CAS 1103527-39-4 is the registry number for ((3-Fluorophenyl)sulfonyl)-L-leucine, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
2-[(3-fluorophenyl)sulfonylamino]-4-methylpentanoic acid (CAS 1103527-39-4) is a chemical compound with the molecular formula C12H16FNO4S and a molecular weight of 289.33 g/mol. IUPAC name: 2-[(3-fluorophenyl)sulfonylamino]-4-methylpentanoic acid. InChIKey: ZYKWMCMFSWWFFG-UHFFFAOYSA-N.
| Molecular formula | C12H16FNO4S |
|---|---|
| Molecular weight | 289.33 g/mol |
| IUPAC name | 2-[(3-fluorophenyl)sulfonylamino]-4-methylpentanoic acid |
| InChIKey | ZYKWMCMFSWWFFG-UHFFFAOYSA-N |
| SMILES | CC(C)CC(C(=O)O)NS(=O)(=O)C1=CC=CC(=C1)F |
Computed by PubChem (NCBI)