CAS 138872-76-1 appears in our catalog under these names: Dideschloro Florfenicol, >95% (HPLC), Dideschloro florfenicol. Offered by: TRC, Biosynth. Available pack sizes: 1mg, 5mg, 2mg, 10mg, 25mg.
N-[(1R,2S)-3-fluoro-1-hydroxy-1-(4-methylsulfonylphenyl)propan-2-yl]acetamide (CAS 138872-76-1) is a chemical compound with the molecular formula C12H16FNO4S and a molecular weight of 289.33 g/mol. IUPAC name: N-[(1R,2S)-3-fluoro-1-hydroxy-1-(4-methylsulfonylphenyl)propan-2-yl]acetamide. InChIKey: SMWQTDMSXSQXOI-VXGBXAGGSA-N.
| Molecular formula | C12H16FNO4S |
|---|---|
| Molecular weight | 289.33 g/mol |
| IUPAC name | N-[(1R,2S)-3-fluoro-1-hydroxy-1-(4-methylsulfonylphenyl)propan-2-yl]acetamide |
| InChIKey | SMWQTDMSXSQXOI-VXGBXAGGSA-N |
| SMILES | CC(=O)N[C@H](CF)[C@@H](C1=CC=C(C=C1)S(=O)(=O)C)O |
Computed by PubChem (NCBI)