CAS 1041510-67-1 appears in our catalog under these names: 3-(3-Aminophenyl)-1-(3-(trifluoromethyl)phenyl)urea, 3-(3-Aminophenyl)-1-(3-(trifluoromethyl)phenyl)urea, 95%. Offered by: Biosynth, AmBeed. Available pack sizes: 100mg, 1g, 5g.
1-(3-aminophenyl)-3-[3-(trifluoromethyl)phenyl]urea (CAS 1041510-67-1) is a chemical compound with the molecular formula C14H12F3N3O and a molecular weight of 295.26 g/mol. IUPAC name: 1-(3-aminophenyl)-3-[3-(trifluoromethyl)phenyl]urea. InChIKey: ANGWGZLLJSBSHH-UHFFFAOYSA-N.
| Molecular formula | C14H12F3N3O |
|---|---|
| Molecular weight | 295.26 g/mol |
| IUPAC name | 1-(3-aminophenyl)-3-[3-(trifluoromethyl)phenyl]urea |
| InChIKey | ANGWGZLLJSBSHH-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)NC(=O)NC2=CC=CC(=C2)N)C(F)(F)F |
Computed by PubChem (NCBI)