CAS 497060-04-5 is the registry number for N-(4,6-dimethylpyrimidin-2-yl)(4-(trifluoromethyl)phenyl)formamide. Offered by: Biosynth. Available pack sizes: 250mg.
N-(4,6-dimethylpyrimidin-2-yl)-4-(trifluoromethyl)benzamide (CAS 497060-04-5) is a chemical compound with the molecular formula C14H12F3N3O and a molecular weight of 295.26 g/mol. IUPAC name: N-(4,6-dimethylpyrimidin-2-yl)-4-(trifluoromethyl)benzamide. InChIKey: KVEIXZSFVFOMOO-UHFFFAOYSA-N.
| Molecular formula | C14H12F3N3O |
|---|---|
| Molecular weight | 295.26 g/mol |
| IUPAC name | N-(4,6-dimethylpyrimidin-2-yl)-4-(trifluoromethyl)benzamide |
| InChIKey | KVEIXZSFVFOMOO-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NC(=N1)NC(=O)C2=CC=C(C=C2)C(F)(F)F)C |
Computed by PubChem (NCBI)