CAS 1421933-32-5 is the registry number for 2,3-Diamino-n-(4-(trifluoromethyl)phenyl)benzamide, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg.
2,3-diamino-N-[4-(trifluoromethyl)phenyl]benzamide (CAS 1421933-32-5) is a chemical compound with the molecular formula C14H12F3N3O and a molecular weight of 295.26 g/mol. IUPAC name: 2,3-diamino-N-[4-(trifluoromethyl)phenyl]benzamide. InChIKey: CXOFLZNSRAUGHX-UHFFFAOYSA-N.
| Molecular formula | C14H12F3N3O |
|---|---|
| Molecular weight | 295.26 g/mol |
| IUPAC name | 2,3-diamino-N-[4-(trifluoromethyl)phenyl]benzamide |
| InChIKey | CXOFLZNSRAUGHX-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)N)N)C(=O)NC2=CC=C(C=C2)C(F)(F)F |
Computed by PubChem (NCBI)