Products 1042348-44-6
CAS 1042348-44-6 is the registry number for 3-Amino-3-oxo-propanoic Acid Phenylmethyl Ester. Offered by: TRC. Available pack sizes: 100mg, 250mg, 50mg.
2-amino-9-[(2R,5R)-3,4-dihydroxy-5-(hydroxymethyl)-3-methyloxolan-2-yl]-1H-purin-6-one (CAS 1042348-44-6) is a chemical compound with the molecular formula C11H15N5O5 and a molecular weight of 297.27 g/mol. IUPAC name: 2-amino-9-[(2R,5R)-3,4-dihydroxy-5-(hydroxymethyl)-3-methyloxolan-2-yl]-1H-purin-6-one. InChIKey: NVKAMPJSWMHVDK-GAXJCLFXSA-N.
| Molecular formula | C11H15N5O5 |
|---|---|
| Molecular weight | 297.27 g/mol |
| IUPAC name | 2-amino-9-[(2R,5R)-3,4-dihydroxy-5-(hydroxymethyl)-3-methyloxolan-2-yl]-1H-purin-6-one |
| InChIKey | NVKAMPJSWMHVDK-GAXJCLFXSA-N |
| SMILES | CC1([C@@H](O[C@@H](C1O)CO)N2C=NC3=C2N=C(NC3=O)N)O |
Computed by PubChem (NCBI)