CAS 88110-89-8 appears in our catalog under these names: Ganciclovir Monoacetate, Ganciclovir Mono-O-acetate, >95% (HPLC), Ganciclovir Mono-O-acetate, Ganciclovir mono–O–acetate, Ganciclovir mono-O-acetate 97%. Offered by: Chemat Brand, TRC, Mikromol, TargetMol, GLPBio. Available pack sizes: on request, 100mg, 250mg, 25mg, 4x25mg, 50mg, 100g, 5g.
[2-[(2-amino-6-oxo-1H-purin-9-yl)methoxy]-3-hydroxypropyl] acetate (CAS 88110-89-8) is a chemical compound with the molecular formula C11H15N5O5 and a molecular weight of 297.27 g/mol. IUPAC name: [2-[(2-amino-6-oxo-1H-purin-9-yl)methoxy]-3-hydroxypropyl] acetate. InChIKey: YKLKCCHLLFMWQE-UHFFFAOYSA-N.
| Molecular formula | C11H15N5O5 |
|---|---|
| Molecular weight | 297.27 g/mol |
| IUPAC name | [2-[(2-amino-6-oxo-1H-purin-9-yl)methoxy]-3-hydroxypropyl] acetate |
| InChIKey | YKLKCCHLLFMWQE-UHFFFAOYSA-N |
| SMILES | CC(=O)OCC(CO)OCN1C=NC2=C1N=C(NC2=O)N |
Computed by PubChem (NCBI)