CAS 1042443-60-6 appears in our catalog under these names: 2-Ethylsulfonylphenylboronic acid, 97%, 2-Ethylsulfonylphenylboronic acid, 98%, 98%. Offered by: Combi-blocks, Chemat. Available pack sizes: 250mg, 1g.
(2-ethylsulfonylphenyl)boronic acid (CAS 1042443-60-6) is a chemical compound with the molecular formula C8H11BO4S and a molecular weight of 214.05 g/mol. IUPAC name: (2-ethylsulfonylphenyl)boronic acid. InChIKey: GNCPGKLAKBQXAU-UHFFFAOYSA-N.
| Molecular formula | C8H11BO4S |
|---|---|
| Molecular weight | 214.05 g/mol |
| IUPAC name | (2-ethylsulfonylphenyl)boronic acid |
| InChIKey | GNCPGKLAKBQXAU-UHFFFAOYSA-N |
| SMILES | B(C1=CC=CC=C1S(=O)(=O)CC)(O)O |
Computed by PubChem (NCBI)