CAS 850033-50-0 appears in our catalog under these names: (4-Methanesulfonyl-2-methylphenyl)boronic acid, 97%, (4-Methanesulfonyl-2-methylphenyl)boronic acid, 97%, 97%. Offered by: Combi-blocks, Chemat, Fluorochem, Ambeed. Available pack sizes: 5g, 1g, 250mg, 100mg.
(2-methyl-4-methylsulfonylphenyl)boronic acid (CAS 850033-50-0) is a chemical compound with the molecular formula C8H11BO4S and a molecular weight of 214.05 g/mol. IUPAC name: (2-methyl-4-methylsulfonylphenyl)boronic acid. InChIKey: KOAZGNLBMZEAMC-UHFFFAOYSA-N.
| Molecular formula | C8H11BO4S |
|---|---|
| Molecular weight | 214.05 g/mol |
| IUPAC name | (2-methyl-4-methylsulfonylphenyl)boronic acid |
| InChIKey | KOAZGNLBMZEAMC-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=C(C=C1)S(=O)(=O)C)C)(O)O |
Computed by PubChem (NCBI)