Products 959861-32-6
CAS 959861-32-6 is the registry number for (4-((Methylsulfonyl)methyl)phenyl)boronic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
[4-(methylsulfonylmethyl)phenyl]boronic acid (CAS 959861-32-6) is a chemical compound with the molecular formula C8H11BO4S and a molecular weight of 214.05 g/mol. IUPAC name: [4-(methylsulfonylmethyl)phenyl]boronic acid. InChIKey: TWTRWXGWOFPBJK-UHFFFAOYSA-N.
| Molecular formula | C8H11BO4S |
|---|---|
| Molecular weight | 214.05 g/mol |
| IUPAC name | [4-(methylsulfonylmethyl)phenyl]boronic acid |
| InChIKey | TWTRWXGWOFPBJK-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)CS(=O)(=O)C)(O)O |
Computed by PubChem (NCBI)
Synonyms:
(4-((Methylsulfonyl)methyl)phenyl)boronic acid, [4-[(methylsulfonyl)methyl]phenyl]boronic acid, TWTRWXGWOFPBJK-UHFFFAOYSA-N, 4-methylsulfonylmethyl-phenylboronic acid, 4-(methylsulfonylmethyl)phenylboronic acid, (4-methanesulfonylmethylphenyl)boronic acid, 4-(methanesulfonylmethyl)phenyl boronic acid, B-[4-[(methylsulfonyl)methyl]phenyl]boronic acid