CAS 1042449-29-5 is the registry number for Almotriptan Impurity 8. Offered by: Chemat Brand. Available pack sizes: on request.
4,5-dichloro-N-[2-(1H-indol-3-yl)ethyl]-1H-pyrrole-2-carboxamide (CAS 1042449-29-5) is a chemical compound with the molecular formula C15H13Cl2N3O and a molecular weight of 322.2 g/mol. IUPAC name: 4,5-dichloro-N-[2-(1H-indol-3-yl)ethyl]-1H-pyrrole-2-carboxamide. InChIKey: NJEQYLOWBHDJRR-UHFFFAOYSA-N.
| Molecular formula | C15H13Cl2N3O |
|---|---|
| Molecular weight | 322.2 g/mol |
| IUPAC name | 4,5-dichloro-N-[2-(1H-indol-3-yl)ethyl]-1H-pyrrole-2-carboxamide |
| InChIKey | NJEQYLOWBHDJRR-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CN2)CCNC(=O)C3=CC(=C(N3)Cl)Cl |
Computed by PubChem (NCBI)