CAS 2750356-93-3 is the registry number for 8-Benzyl-2,4-dichloro-5,6,7,8-tetrahydro-9H-pyrimido[4,5-c]azepin-9-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
8-benzyl-2,4-dichloro-6,7-dihydro-5H-pyrimido[4,5-c]azepin-9-one (CAS 2750356-93-3) is a chemical compound with the molecular formula C15H13Cl2N3O and a molecular weight of 322.2 g/mol. IUPAC name: 8-benzyl-2,4-dichloro-6,7-dihydro-5H-pyrimido[4,5-c]azepin-9-one. InChIKey: STZIWKDVRAUEIM-UHFFFAOYSA-N.
| Molecular formula | C15H13Cl2N3O |
|---|---|
| Molecular weight | 322.2 g/mol |
| IUPAC name | 8-benzyl-2,4-dichloro-6,7-dihydro-5H-pyrimido[4,5-c]azepin-9-one |
| InChIKey | STZIWKDVRAUEIM-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C(=O)N(C1)CC3=CC=CC=C3)N=C(N=C2Cl)Cl |
Computed by PubChem (NCBI)