CAS 54567-12-3 appears in our catalog under these names: Triazolam Impurity 1, 3-Amino-6-chloro-4-(2-chlorophenyl)-3,4-hydroxy-2-methylquinazoline. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 500mg.
3-amino-6-chloro-4-(2-chlorophenyl)-2-methylquinazolin-4-ol (CAS 54567-12-3) is a chemical compound with the molecular formula C15H13Cl2N3O and a molecular weight of 322.2 g/mol. IUPAC name: 3-amino-6-chloro-4-(2-chlorophenyl)-2-methylquinazolin-4-ol. InChIKey: BLYWAXNJULTJLN-UHFFFAOYSA-N.
| Molecular formula | C15H13Cl2N3O |
|---|---|
| Molecular weight | 322.2 g/mol |
| IUPAC name | 3-amino-6-chloro-4-(2-chlorophenyl)-2-methylquinazolin-4-ol |
| InChIKey | BLYWAXNJULTJLN-UHFFFAOYSA-N |
| SMILES | CC1=NC2=C(C=C(C=C2)Cl)C(N1N)(C3=CC=CC=C3Cl)O |
Computed by PubChem (NCBI)