Products 1042534-41-7
CAS 1042534-41-7 appears in our catalog under these names: 1-(4-Ethoxyphenyl)-1H-1,2,3-triazole-4-carboxylic acid, 98%, 98%, 1-(4-Ethoxyphenyl)-1H-1,2,3-triazole-4-carboxylic acid, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 1g, 250mg.
1-(4-ethoxyphenyl)triazole-4-carboxylic acid (CAS 1042534-41-7) is a chemical compound with the molecular formula C11H11N3O3 and a molecular weight of 233.22 g/mol. IUPAC name: 1-(4-ethoxyphenyl)triazole-4-carboxylic acid. InChIKey: VWRYLLXUYOWNOC-UHFFFAOYSA-N.
| Molecular formula | C11H11N3O3 |
|---|---|
| Molecular weight | 233.22 g/mol |
| IUPAC name | 1-(4-ethoxyphenyl)triazole-4-carboxylic acid |
| InChIKey | VWRYLLXUYOWNOC-UHFFFAOYSA-N |
| SMILES | CCOC1=CC=C(C=C1)N2C=C(N=N2)C(=O)O |
Computed by PubChem (NCBI)