CAS 1214640-04-6 appears in our catalog under these names: 5-Methyl-6-oxo-1-phenyl-1,4,5,6-tetrahydro-1,2,4-triazine-3-carboxylic acid, 95%, 5-Methyl-6-oxo-1-phenyl-1,4,5,6-tetrahydro-1,2,4-triazine-3-carboxylic acid. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 2,5g.
5-methyl-6-oxo-1-phenyl-2,5-dihydro-1,2,4-triazine-3-carboxylic acid (CAS 1214640-04-6) is a chemical compound with the molecular formula C11H11N3O3 and a molecular weight of 233.22 g/mol. IUPAC name: 5-methyl-6-oxo-1-phenyl-2,5-dihydro-1,2,4-triazine-3-carboxylic acid. InChIKey: BNUVSNJZDYXDML-UHFFFAOYSA-N.
| Molecular formula | C11H11N3O3 |
|---|---|
| Molecular weight | 233.22 g/mol |
| IUPAC name | 5-methyl-6-oxo-1-phenyl-2,5-dihydro-1,2,4-triazine-3-carboxylic acid |
| InChIKey | BNUVSNJZDYXDML-UHFFFAOYSA-N |
| SMILES | CC1C(=O)N(NC(=N1)C(=O)O)C2=CC=CC=C2 |
Computed by PubChem (NCBI)