CAS 4916-13-6 appears in our catalog under these names: 1-(4-Methoxybenzyl)-1h-1,2,3-triazole-4-carboxylic acid, 95%, 1-(4-Methoxyphenyl)-1H-1,2,3-triazole-4-carboxylic acid, 97%, 1-(4-Methoxyphenyl)-1H-1,2,3-triazole-4-carboxylic acid. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 10g, 5g, 1g, 250mg, 0,5g, 50mg.
1-[(4-methoxyphenyl)methyl]triazole-4-carboxylic acid (CAS 4916-13-6) is a chemical compound with the molecular formula C11H11N3O3 and a molecular weight of 233.22 g/mol. IUPAC name: 1-[(4-methoxyphenyl)methyl]triazole-4-carboxylic acid. InChIKey: WOVCZGZVFJWZBD-UHFFFAOYSA-N.
| Molecular formula | C11H11N3O3 |
|---|---|
| Molecular weight | 233.22 g/mol |
| IUPAC name | 1-[(4-methoxyphenyl)methyl]triazole-4-carboxylic acid |
| InChIKey | WOVCZGZVFJWZBD-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)CN2C=C(N=N2)C(=O)O |
Computed by PubChem (NCBI)