CAS 1042534-72-4 appears in our catalog under these names: 3–{((4–fluorophenyl)methyl)amino}benzamide, 3-{((4-Fluorophenyl)methyl)amino}benzamide, 3-{[(4-fluorophenyl)methyl]amino}benzamide 95%, 3-{[(4-fluorophenyl)methyl]amino}benzamide, 95%, 3-{[(4-fluorophenyl)methyl]amino}benzamide, 95%, 95%. Offered by: GLPBio, Biosynth, Ambeed, Fluorochem, Chemat. Available pack sizes: 100mg, 2,5g, 250mg, 1g, 5g.
3-[(4-fluorophenyl)methylamino]benzamide (CAS 1042534-72-4) is a chemical compound with the molecular formula C14H13FN2O and a molecular weight of 244.26 g/mol. IUPAC name: 3-[(4-fluorophenyl)methylamino]benzamide. InChIKey: MUJUVCOIMMGFNB-UHFFFAOYSA-N.
| Molecular formula | C14H13FN2O |
|---|---|
| Molecular weight | 244.26 g/mol |
| IUPAC name | 3-[(4-fluorophenyl)methylamino]benzamide |
| InChIKey | MUJUVCOIMMGFNB-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)NCC2=CC=C(C=C2)F)C(=O)N |
Computed by PubChem (NCBI)