CAS 1042556-50-2 is the registry number for 4-Sulfamoyl-1H-pyrrole-2-carboxylic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
4-sulfamoyl-1H-pyrrole-2-carboxylic acid (CAS 1042556-50-2) is a chemical compound with the molecular formula C5H6N2O4S and a molecular weight of 190.18 g/mol. IUPAC name: 4-sulfamoyl-1H-pyrrole-2-carboxylic acid. InChIKey: DSRIAQJIFHUAEB-UHFFFAOYSA-N.
| Molecular formula | C5H6N2O4S |
|---|---|
| Molecular weight | 190.18 g/mol |
| IUPAC name | 4-sulfamoyl-1H-pyrrole-2-carboxylic acid |
| InChIKey | DSRIAQJIFHUAEB-UHFFFAOYSA-N |
| SMILES | C1=C(NC=C1S(=O)(=O)N)C(=O)O |
Computed by PubChem (NCBI)