Products 2168155-07-3

CAS 2168155-07-3 is the registry number for 1-(Methylsulfonyl)-1H-pyrazole-3-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

1-methylsulfonylpyrazole-3-carboxylic acid (CAS 2168155-07-3) is a chemical compound with the molecular formula C5H6N2O4S and a molecular weight of 190.18 g/mol. IUPAC name: 1-methylsulfonylpyrazole-3-carboxylic acid. InChIKey: AMKXTGBOWXWXEG-UHFFFAOYSA-N.

Identity
Molecular formulaC5H6N2O4S
Molecular weight190.18 g/mol
IUPAC name1-methylsulfonylpyrazole-3-carboxylic acid
InChIKeyAMKXTGBOWXWXEG-UHFFFAOYSA-N
SMILESCS(=O)(=O)N1C=CC(=N1)C(=O)O

Computed by PubChem (NCBI)