CAS 2306268-92-6 is the registry number for 1-(Methylsulfonyl)-1H-pyrazole-4-carboxylic acid, 98%. Offered by: AmBeed. Available pack sizes: 1g, 250mg, 5g.
1-methylsulfonylpyrazole-4-carboxylic acid (CAS 2306268-92-6) is a chemical compound with the molecular formula C5H6N2O4S and a molecular weight of 190.18 g/mol. IUPAC name: 1-methylsulfonylpyrazole-4-carboxylic acid. InChIKey: OUMPRUVGTWDQNG-UHFFFAOYSA-N.
| Molecular formula | C5H6N2O4S |
|---|---|
| Molecular weight | 190.18 g/mol |
| IUPAC name | 1-methylsulfonylpyrazole-4-carboxylic acid |
| InChIKey | OUMPRUVGTWDQNG-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)N1C=C(C=N1)C(=O)O |
Computed by PubChem (NCBI)