Products 1042561-91-0
CAS 1042561-91-0 is the registry number for 3-((4-Methyl-1,4-diazepan-1-yl)sulfonyl)aniline. Offered by: Biosynth. Available pack sizes: 250mg, 2,5g.
3-[(4-methyl-1,4-diazepan-1-yl)sulfonyl]aniline (CAS 1042561-91-0) is a chemical compound with the molecular formula C12H19N3O2S and a molecular weight of 269.37 g/mol. IUPAC name: 3-[(4-methyl-1,4-diazepan-1-yl)sulfonyl]aniline. InChIKey: HQAWKHGOPHJYFT-UHFFFAOYSA-N.
| Molecular formula | C12H19N3O2S |
|---|---|
| Molecular weight | 269.37 g/mol |
| IUPAC name | 3-[(4-methyl-1,4-diazepan-1-yl)sulfonyl]aniline |
| InChIKey | HQAWKHGOPHJYFT-UHFFFAOYSA-N |
| SMILES | CN1CCCN(CC1)S(=O)(=O)C2=CC=CC(=C2)N |
Computed by PubChem (NCBI)