Products 1781357-63-8
CAS 1781357-63-8 is the registry number for tert-Butyl (6-amino-4,5,6,7-tetrahydrobenzo[d]thiazol-2-yl)carbamate, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 250mg.
Tert-butyl N-(6-amino-4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)carbamate (CAS 1781357-63-8) is a chemical compound with the molecular formula C12H19N3O2S and a molecular weight of 269.37 g/mol. IUPAC name: tert-butyl N-(6-amino-4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)carbamate. InChIKey: OMBSPLFLJONFRP-UHFFFAOYSA-N.
| Molecular formula | C12H19N3O2S |
|---|---|
| Molecular weight | 269.37 g/mol |
| IUPAC name | tert-butyl N-(6-amino-4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)carbamate |
| InChIKey | OMBSPLFLJONFRP-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1=NC2=C(S1)CC(CC2)N |
Computed by PubChem (NCBI)