Products 867330-06-1

CAS 867330-06-1 is the registry number for Ethyl (4-cyclohexyl-5-mercapto-4h-1,2,4-triazol-3-yl)acetate, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 250mg, 1g, 100mg.

Structural formula: {0} (CAS {1})

Ethyl 2-(4-cyclohexyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)acetate (CAS 867330-06-1) is a chemical compound with the molecular formula C12H19N3O2S and a molecular weight of 269.37 g/mol. IUPAC name: ethyl 2-(4-cyclohexyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)acetate. InChIKey: FFWGQDVNCMFKBS-UHFFFAOYSA-N.

Identity
Molecular formulaC12H19N3O2S
Molecular weight269.37 g/mol
IUPAC nameethyl 2-(4-cyclohexyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)acetate
InChIKeyFFWGQDVNCMFKBS-UHFFFAOYSA-N
SMILESCCOC(=O)CC1=NNC(=S)N1C2CCCCC2

Computed by PubChem (NCBI)