Products 1042580-33-5
CAS 1042580-33-5 appears in our catalog under these names: N-(4-Hydroxyphenyl)-n,2-dimethylpropanamide, 95%, N–(4–Hydroxyphenyl)–N–methylisobutyramide. Offered by: Combi-blocks, GLPBio. Available pack sizes: 1g, 250mg, 5g, 100mg.
N-(4-hydroxyphenyl)-N,2-dimethylpropanamide (CAS 1042580-33-5) is a chemical compound with the molecular formula C11H15NO2 and a molecular weight of 193.24 g/mol. IUPAC name: N-(4-hydroxyphenyl)-N,2-dimethylpropanamide. InChIKey: BFULDWTZLIXTDF-UHFFFAOYSA-N.
| Molecular formula | C11H15NO2 |
|---|---|
| Molecular weight | 193.24 g/mol |
| IUPAC name | N-(4-hydroxyphenyl)-N,2-dimethylpropanamide |
| InChIKey | BFULDWTZLIXTDF-UHFFFAOYSA-N |
| SMILES | CC(C)C(=O)N(C)C1=CC=C(C=C1)O |
Computed by PubChem (NCBI)