CAS 104390-83-2 appears in our catalog under these names: 2-(Azetidin-3-yl)isoindoline-1,3-dione, 97%, 3-Phthalimidoazetidine. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 5g.
2-(azetidin-3-yl)isoindole-1,3-dione (CAS 104390-83-2) is a chemical compound with the molecular formula C11H10N2O2 and a molecular weight of 202.21 g/mol. IUPAC name: 2-(azetidin-3-yl)isoindole-1,3-dione. InChIKey: CCUNVVKGBQMMQU-UHFFFAOYSA-N.
| Molecular formula | C11H10N2O2 |
|---|---|
| Molecular weight | 202.21 g/mol |
| IUPAC name | 2-(azetidin-3-yl)isoindole-1,3-dione |
| InChIKey | CCUNVVKGBQMMQU-UHFFFAOYSA-N |
| SMILES | C1C(CN1)N2C(=O)C3=CC=CC=C3C2=O |
Computed by PubChem (NCBI)