CAS 104392-63-4 appears in our catalog under these names: 5-(Bromomethyl)-3-(4-chlorophenyl)-1,3-oxazolidin-2-one, 95%, 5-(Bromomethyl)-3-(4-chlorophenyl)-1,3-oxazolidin-2-one. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 100mg.
5-(bromomethyl)-3-(4-chlorophenyl)-1,3-oxazolidin-2-one (CAS 104392-63-4) is a chemical compound with the molecular formula C10H9BrClNO2 and a molecular weight of 290.54 g/mol. IUPAC name: 5-(bromomethyl)-3-(4-chlorophenyl)-1,3-oxazolidin-2-one. InChIKey: LLLOCFSPYKDCOM-UHFFFAOYSA-N.
| Molecular formula | C10H9BrClNO2 |
|---|---|
| Molecular weight | 290.54 g/mol |
| IUPAC name | 5-(bromomethyl)-3-(4-chlorophenyl)-1,3-oxazolidin-2-one |
| InChIKey | LLLOCFSPYKDCOM-UHFFFAOYSA-N |
| SMILES | C1C(OC(=O)N1C2=CC=C(C=C2)Cl)CBr |
Computed by PubChem (NCBI)