Products 874472-83-0
CAS 874472-83-0 is the registry number for 6-Bromo-5-chloro-4,4-dimethyl-1,4-dihydro-2H-benzo[d][1,3]oxazin-2-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
6-bromo-5-chloro-4,4-dimethyl-1H-3,1-benzoxazin-2-one (CAS 874472-83-0) is a chemical compound with the molecular formula C10H9BrClNO2 and a molecular weight of 290.54 g/mol. IUPAC name: 6-bromo-5-chloro-4,4-dimethyl-1H-3,1-benzoxazin-2-one. InChIKey: GHFFTXFRPXTMMK-UHFFFAOYSA-N.
| Molecular formula | C10H9BrClNO2 |
|---|---|
| Molecular weight | 290.54 g/mol |
| IUPAC name | 6-bromo-5-chloro-4,4-dimethyl-1H-3,1-benzoxazin-2-one |
| InChIKey | GHFFTXFRPXTMMK-UHFFFAOYSA-N |
| SMILES | CC1(C2=C(C=CC(=C2Cl)Br)NC(=O)O1)C |
Computed by PubChem (NCBI)