Products 1094298-71-1
CAS 1094298-71-1 is the registry number for 6-Bromo-4-(2-chloroethyl)-3,4-dihydro-2H-1,4-benzoxazin-3-one. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
6-bromo-4-(2-chloroethyl)-1,4-benzoxazin-3-one (CAS 1094298-71-1) is a chemical compound with the molecular formula C10H9BrClNO2 and a molecular weight of 290.54 g/mol. IUPAC name: 6-bromo-4-(2-chloroethyl)-1,4-benzoxazin-3-one. InChIKey: OZSIZAJKVCSLKG-UHFFFAOYSA-N.
| Molecular formula | C10H9BrClNO2 |
|---|---|
| Molecular weight | 290.54 g/mol |
| IUPAC name | 6-bromo-4-(2-chloroethyl)-1,4-benzoxazin-3-one |
| InChIKey | OZSIZAJKVCSLKG-UHFFFAOYSA-N |
| SMILES | C1C(=O)N(C2=C(O1)C=CC(=C2)Br)CCCl |
Computed by PubChem (NCBI)