CAS 104412-17-1 is the registry number for Mesitylglycine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(2,4,6-trimethylanilino)acetic acid (CAS 104412-17-1) is a chemical compound with the molecular formula C11H15NO2 and a molecular weight of 193.24 g/mol. IUPAC name: 2-(2,4,6-trimethylanilino)acetic acid. InChIKey: CLFUVLYLVSYUQS-UHFFFAOYSA-N.
| Molecular formula | C11H15NO2 |
|---|---|
| Molecular weight | 193.24 g/mol |
| IUPAC name | 2-(2,4,6-trimethylanilino)acetic acid |
| InChIKey | CLFUVLYLVSYUQS-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1)C)NCC(=O)O)C |
Computed by PubChem (NCBI)