Products 104417-65-4
CAS 104417-65-4 is the registry number for 3-(4-chlorophenyl)-2,4-dimethylpentan-3-ol, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
3-(4-chlorophenyl)-2,4-dimethylpentan-3-ol (CAS 104417-65-4) is a chemical compound with the molecular formula C13H19ClO and a molecular weight of 226.74 g/mol. IUPAC name: 3-(4-chlorophenyl)-2,4-dimethylpentan-3-ol. InChIKey: CZIJHEOMTNUAOP-UHFFFAOYSA-N.
| Molecular formula | C13H19ClO |
|---|---|
| Molecular weight | 226.74 g/mol |
| IUPAC name | 3-(4-chlorophenyl)-2,4-dimethylpentan-3-ol |
| InChIKey | CZIJHEOMTNUAOP-UHFFFAOYSA-N |
| SMILES | CC(C)C(C1=CC=C(C=C1)Cl)(C(C)C)O |
Computed by PubChem (NCBI)