CAS 23500-79-0 appears in our catalog under these names: Oxymetazoline Impurity 4, 6-tert-Butyl-3-(chloromethyl)-2,4-dimethylphenol. Offered by: Chemat Brand, Biosynth. Available pack sizes: on request, 0,5g, 50mg.
6-tert-butyl-3-(chloromethyl)-2,4-dimethylphenol (CAS 23500-79-0) is a chemical compound with the molecular formula C13H19ClO and a molecular weight of 226.74 g/mol. IUPAC name: 6-tert-butyl-3-(chloromethyl)-2,4-dimethylphenol. InChIKey: WODZSHMAILHEGD-UHFFFAOYSA-N.
| Molecular formula | C13H19ClO |
|---|---|
| Molecular weight | 226.74 g/mol |
| IUPAC name | 6-tert-butyl-3-(chloromethyl)-2,4-dimethylphenol |
| InChIKey | WODZSHMAILHEGD-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1CCl)C)O)C(C)(C)C |
Computed by PubChem (NCBI)