CAS 258516-82-4 is the registry number for 2-(Chloromethoxy)-1,3-diisopropylbenzene, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(chloromethoxy)-1,3-di(propan-2-yl)benzene (CAS 258516-82-4) is a chemical compound with the molecular formula C13H19ClO and a molecular weight of 226.74 g/mol. IUPAC name: 2-(chloromethoxy)-1,3-di(propan-2-yl)benzene. InChIKey: XYMTUFXXCMZHCU-UHFFFAOYSA-N.
| Molecular formula | C13H19ClO |
|---|---|
| Molecular weight | 226.74 g/mol |
| IUPAC name | 2-(chloromethoxy)-1,3-di(propan-2-yl)benzene |
| InChIKey | XYMTUFXXCMZHCU-UHFFFAOYSA-N |
| SMILES | CC(C)C1=C(C(=CC=C1)C(C)C)OCCl |
Computed by PubChem (NCBI)