CAS 104468-87-3 appears in our catalog under these names: Pyrazolo[1,5-a]pyridine-5-carboxylic acid 96%, Pyrazolo[1,5-a]pyridine-5-carboxylic acid, 97%, 97%, PYRAZOLO[1,5-A]PYRIDINE-5-CARBOXYLIC ACID, 95%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g, 100mg.
Pyrazolo[1,5-a]pyridine-5-carboxylic acid (CAS 104468-87-3) is a chemical compound with the molecular formula C8H6N2O2 and a molecular weight of 162.15 g/mol. IUPAC name: pyrazolo[1,5-a]pyridine-5-carboxylic acid. InChIKey: PKBWKZMOZIZGJB-UHFFFAOYSA-N.
| Molecular formula | C8H6N2O2 |
|---|---|
| Molecular weight | 162.15 g/mol |
| IUPAC name | pyrazolo[1,5-a]pyridine-5-carboxylic acid |
| InChIKey | PKBWKZMOZIZGJB-UHFFFAOYSA-N |
| SMILES | C1=CN2C(=CC=N2)C=C1C(=O)O |
Computed by PubChem (NCBI)