CAS 10447-38-8 is the registry number for Quifenadine (hydrochloride). Offered by: MedChemExpress. Available pack sizes: Get quote.
1-azabicyclo[2.2.2]octan-3-yl(diphenyl)methanol;hydrochloride (CAS 10447-38-8) is a chemical compound with the molecular formula C20H24ClNO and a molecular weight of 329.9 g/mol. IUPAC name: 1-azabicyclo[2.2.2]octan-3-yl(diphenyl)methanol;hydrochloride. InChIKey: MVCBFPDJWSQMNY-UHFFFAOYSA-N.
| Molecular formula | C20H24ClNO |
|---|---|
| Molecular weight | 329.9 g/mol |
| IUPAC name | 1-azabicyclo[2.2.2]octan-3-yl(diphenyl)methanol;hydrochloride |
| InChIKey | MVCBFPDJWSQMNY-UHFFFAOYSA-N |
| SMILES | C1CN2CCC1C(C2)C(C3=CC=CC=C3)(C4=CC=CC=C4)O.Cl |
Computed by PubChem (NCBI)