Products 4290-60-2
CAS 4290-60-2 is the registry number for Amitriptyline N-Oxide Hydrochloride. Offered by: Mikromol. Available pack sizes: 10mg.
N,N-dimethyl-3-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaenylidene)propan-1-amine oxide;hydrochloride (CAS 4290-60-2) is a chemical compound with the molecular formula C20H24ClNO and a molecular weight of 329.9 g/mol. IUPAC name: N,N-dimethyl-3-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaenylidene)propan-1-amine oxide;hydrochloride. InChIKey: ZELYQHCTXSGSGS-UHFFFAOYSA-N.
| Molecular formula | C20H24ClNO |
|---|---|
| Molecular weight | 329.9 g/mol |
| IUPAC name | N,N-dimethyl-3-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaenylidene)propan-1-amine oxide;hydrochloride |
| InChIKey | ZELYQHCTXSGSGS-UHFFFAOYSA-N |
| SMILES | C[N+](C)(CCC=C1C2=CC=CC=C2CCC3=CC=CC=C31)[O-].Cl |
Computed by PubChem (NCBI)