Products 1044837-24-2
CAS 1044837-24-2 appears in our catalog under these names: 3-(2,5-Dimethylphenyl)-1h-pyrazole-5-carbohydrazide, 95%, 3-(2,5-Dimethylphenyl)-1H-pyrazole-5-carbohydrazide. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 10g, 250mg, 100mg, 1g, 2,5g.
3-(2,5-dimethylphenyl)-1H-pyrazole-5-carbohydrazide (CAS 1044837-24-2) is a chemical compound with the molecular formula C12H14N4O and a molecular weight of 230.27 g/mol. IUPAC name: 3-(2,5-dimethylphenyl)-1H-pyrazole-5-carbohydrazide. InChIKey: YTHQGRVYNBONOR-UHFFFAOYSA-N.
| Molecular formula | C12H14N4O |
|---|---|
| Molecular weight | 230.27 g/mol |
| IUPAC name | 3-(2,5-dimethylphenyl)-1H-pyrazole-5-carbohydrazide |
| InChIKey | YTHQGRVYNBONOR-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)C)C2=NNC(=C2)C(=O)NN |
Computed by PubChem (NCBI)