CAS 328035-71-8 is the registry number for N,N-Dimethyl-n'-(5-oxo-1-phenyl-2,5-dihydro-1h-pyrazol-3-yl)imidoformamide, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
N,N-dimethyl-N'-(3-oxo-2-phenyl-1H-pyrazol-5-yl)methanimidamide (CAS 328035-71-8) is a chemical compound with the molecular formula C12H14N4O and a molecular weight of 230.27 g/mol. IUPAC name: N,N-dimethyl-N'-(3-oxo-2-phenyl-1H-pyrazol-5-yl)methanimidamide. InChIKey: OXBJXKHZLXNXFA-UKTHLTGXSA-N.
| Molecular formula | C12H14N4O |
|---|---|
| Molecular weight | 230.27 g/mol |
| IUPAC name | N,N-dimethyl-N'-(3-oxo-2-phenyl-1H-pyrazol-5-yl)methanimidamide |
| InChIKey | OXBJXKHZLXNXFA-UKTHLTGXSA-N |
| SMILES | CN(C)/C=N/C1=CC(=O)N(N1)C2=CC=CC=C2 |
Computed by PubChem (NCBI)