CAS 618092-44-7 is the registry number for 5-Methyl-1-p-tolyl-1h-pyrazole-4-carbohydrazide, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
5-methyl-1-(4-methylphenyl)pyrazole-4-carbohydrazide (CAS 618092-44-7) is a chemical compound with the molecular formula C12H14N4O and a molecular weight of 230.27 g/mol. IUPAC name: 5-methyl-1-(4-methylphenyl)pyrazole-4-carbohydrazide. InChIKey: OLDCCJMGQXRSSP-UHFFFAOYSA-N.
| Molecular formula | C12H14N4O |
|---|---|
| Molecular weight | 230.27 g/mol |
| IUPAC name | 5-methyl-1-(4-methylphenyl)pyrazole-4-carbohydrazide |
| InChIKey | OLDCCJMGQXRSSP-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)N2C(=C(C=N2)C(=O)NN)C |
Computed by PubChem (NCBI)