CAS 104509-24-2 is the registry number for 2-Bromo-n-mesitylpropanamide, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
2-bromo-N-(2,4,6-trimethylphenyl)propanamide (CAS 104509-24-2) is a chemical compound with the molecular formula C12H16BrNO and a molecular weight of 270.17 g/mol. IUPAC name: 2-bromo-N-(2,4,6-trimethylphenyl)propanamide. InChIKey: PFUNDKIYLSGFMW-UHFFFAOYSA-N.
| Molecular formula | C12H16BrNO |
|---|---|
| Molecular weight | 270.17 g/mol |
| IUPAC name | 2-bromo-N-(2,4,6-trimethylphenyl)propanamide |
| InChIKey | PFUNDKIYLSGFMW-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1)C)NC(=O)C(C)Br)C |
Computed by PubChem (NCBI)