CAS 10464-24-1 appears in our catalog under these names: N-Demethyl Trimipramine Hydrochloride, >95% (HPLC), Desmethyltrimipramine Hydrochloride, Desmethyltrimipramine Hydrochloride 1.0 mg/ml in Methanol (as free base), Trimipramine Maleate EP Impurity B (as Hydrochloride). Offered by: TRC, LoGiCal, Mikromol. Available pack sizes: 1mg, 5mg, 10mg, 1ml, 25mg, 100mg.
3-(5,6-dihydrobenzo[b][1]benzazepin-11-yl)-N,2-dimethylpropan-1-amine;hydrochloride (CAS 10464-24-1) is a chemical compound with the molecular formula C19H25ClN2 and a molecular weight of 316.9 g/mol. IUPAC name: 3-(5,6-dihydrobenzo[b][1]benzazepin-11-yl)-N,2-dimethylpropan-1-amine;hydrochloride. InChIKey: LRSZUGQWBGGCTG-UHFFFAOYSA-N.
| Molecular formula | C19H25ClN2 |
|---|---|
| Molecular weight | 316.9 g/mol |
| IUPAC name | 3-(5,6-dihydrobenzo[b][1]benzazepin-11-yl)-N,2-dimethylpropan-1-amine;hydrochloride |
| InChIKey | LRSZUGQWBGGCTG-UHFFFAOYSA-N |
| SMILES | CC(CNC)CN1C2=CC=CC=C2CCC3=CC=CC=C31.Cl |
Computed by PubChem (NCBI)