CAS 61361-33-9 appears in our catalog under these names: Imipramine-2,4,6,8-d4 Hydrochloride, >95% (HPLC), Imipramine-2,4,6,8-d4 HCl, 98 atom % D, min 98% Chemical Purity, Imipramine–d4 hydrochloride, Imipramine-d4 (hydrochloride), 99.95%. Offered by: TRC, CDN, GLPBio, MedChemExpress. Available pack sizes: 1mg, 0,01g, 0,005g, 1 mg, 5 mg.
N,N-dimethyl-3-(1,3,8,10-tetradeuterio-5,6-dihydrobenzo[b][1]benzazepin-11-yl)propan-1-amine;hydrochloride (CAS 61361-33-9) is a chemical compound with the molecular formula C19H25ClN2 and a molecular weight of 320.9 g/mol. IUPAC name: N,N-dimethyl-3-(1,3,8,10-tetradeuterio-5,6-dihydrobenzo[b][1]benzazepin-11-yl)propan-1-amine;hydrochloride. InChIKey: XZZXIYZZBJDEEP-PTAOTMHMSA-N.
| Molecular formula | C19H25ClN2 |
|---|---|
| Molecular weight | 320.9 g/mol |
| IUPAC name | N,N-dimethyl-3-(1,3,8,10-tetradeuterio-5,6-dihydrobenzo[b][1]benzazepin-11-yl)propan-1-amine;hydrochloride |
| InChIKey | XZZXIYZZBJDEEP-PTAOTMHMSA-N |
| SMILES | [2H]C1=CC(=C2C(=C1)CCC3=CC(=CC(=C3N2CCCN(C)C)[2H])[2H])[2H].Cl |
Computed by PubChem (NCBI)