Products 113-52-0
CAS 113-52-0 appears in our catalog under these names: Clomipramine HCl EP Impurity B HCl (Imipramine HCl), Imipramine HCl (Clomipramine HCl EP Impurity B HCl), Imipramine Hydrochloride, >95% (HPLC), Imipramine Hydrochloride, Imipramine Hydrochloride 1.0 mg/ml in Methanol (as free base). Offered by: Chemat Brand, TRC, Mikromol, LoGiCal, Dr. Ehrenstorfer. Available pack sizes: on request, 10g, 1g, 5g, 250mg, 10mg, 50mg, 1ml.
3-(5,6-dihydrobenzo[b][1]benzazepin-11-yl)-N,N-dimethylpropan-1-amine;hydrochloride (CAS 113-52-0) is a chemical compound with the molecular formula C19H25ClN2 and a molecular weight of 316.9 g/mol. IUPAC name: 3-(5,6-dihydrobenzo[b][1]benzazepin-11-yl)-N,N-dimethylpropan-1-amine;hydrochloride. InChIKey: XZZXIYZZBJDEEP-UHFFFAOYSA-N.
| Molecular formula | C19H25ClN2 |
|---|---|
| Molecular weight | 316.9 g/mol |
| IUPAC name | 3-(5,6-dihydrobenzo[b][1]benzazepin-11-yl)-N,N-dimethylpropan-1-amine;hydrochloride |
| InChIKey | XZZXIYZZBJDEEP-UHFFFAOYSA-N |
| SMILES | CN(C)CCCN1C2=CC=CC=C2CCC3=CC=CC=C31.Cl |
Computed by PubChem (NCBI)