CAS 104662-84-2 is the registry number for 6-Chloro-3-oxo-3,4-dihydro-2H-benzo[b][1,4]oxazin-2-yl propionate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 2-(6-chloro-3-oxo-4H-1,4-benzoxazin-2-yl)acetate (CAS 104662-84-2) is a chemical compound with the molecular formula C11H10ClNO4 and a molecular weight of 255.65 g/mol. IUPAC name: methyl 2-(6-chloro-3-oxo-4H-1,4-benzoxazin-2-yl)acetate. InChIKey: CNOULAOXZGSIEF-UHFFFAOYSA-N.
| Molecular formula | C11H10ClNO4 |
|---|---|
| Molecular weight | 255.65 g/mol |
| IUPAC name | methyl 2-(6-chloro-3-oxo-4H-1,4-benzoxazin-2-yl)acetate |
| InChIKey | CNOULAOXZGSIEF-UHFFFAOYSA-N |
| SMILES | COC(=O)CC1C(=O)NC2=C(O1)C=CC(=C2)Cl |
Computed by PubChem (NCBI)