Products 104662-84-2

CAS 104662-84-2 is the registry number for 6-Chloro-3-oxo-3,4-dihydro-2H-benzo[b][1,4]oxazin-2-yl propionate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

Methyl 2-(6-chloro-3-oxo-4H-1,4-benzoxazin-2-yl)acetate (CAS 104662-84-2) is a chemical compound with the molecular formula C11H10ClNO4 and a molecular weight of 255.65 g/mol. IUPAC name: methyl 2-(6-chloro-3-oxo-4H-1,4-benzoxazin-2-yl)acetate. InChIKey: CNOULAOXZGSIEF-UHFFFAOYSA-N.

Identity
Molecular formulaC11H10ClNO4
Molecular weight255.65 g/mol
IUPAC namemethyl 2-(6-chloro-3-oxo-4H-1,4-benzoxazin-2-yl)acetate
InChIKeyCNOULAOXZGSIEF-UHFFFAOYSA-N
SMILESCOC(=O)CC1C(=O)NC2=C(O1)C=CC(=C2)Cl

Computed by PubChem (NCBI)