CAS 454241-27-1 is the registry number for 2-Oxotetrahydrofuran-3-yl 3-amino-4-chlorobenzoate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
(2-oxooxolan-3-yl) 3-amino-4-chlorobenzoate (CAS 454241-27-1) is a chemical compound with the molecular formula C11H10ClNO4 and a molecular weight of 255.65 g/mol. IUPAC name: (2-oxooxolan-3-yl) 3-amino-4-chlorobenzoate. InChIKey: HZIIVNGCTSODAS-UHFFFAOYSA-N.
| Molecular formula | C11H10ClNO4 |
|---|---|
| Molecular weight | 255.65 g/mol |
| IUPAC name | (2-oxooxolan-3-yl) 3-amino-4-chlorobenzoate |
| InChIKey | HZIIVNGCTSODAS-UHFFFAOYSA-N |
| SMILES | C1COC(=O)C1OC(=O)C2=CC(=C(C=C2)Cl)N |
Computed by PubChem (NCBI)